Amphotericin B

Description: Amphotericin B (NSC-527017) is a polyene antifungal agent with broad-spectrum activity against many fungal species. Amphotericin B irreversibly binds to ergosterol and disrupts the integrity of cell membranes, resulting in antifungal activity. Target: Antibiotic, Antifungal. Smiles: [H][C@]12C[C@@]([H])(O[C@@H]3O[C@H](C)[C@@H](O)[C@H](N)[C@@H]3O)\C=C\C=C\C=C\C=C\C=C\C=C\C=C\[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@@H](O)C[C@@H](O)CC[C@H](O)[C@@H](O)C[C@@H](O)C[C@](O)(C[C@H](O)[C@H]1C(O)=O)O2. References: Grela E, et al. Imaging of human cells exposed to an antifungal antibiotic amphotericin B reveals the mechanisms associated with the drug toxicity and cell defence. Sci Rep. 2018 Sep 14,8(1):14067.